About azane;butane-1,3-diamine;pentane-1,3-diamine
azane;butane-1,3-diamine;pentane-1,3-diamine (PubChem CID 174966617) has the molecular formula C9H29N5
and a molecular weight of 207.37 g/mol. Its IUPAC name is azane;butane-1,3-diamine;pentane-1,3-diamine.
Molecular Properties
| Compound Name | azane;butane-1,3-diamine;pentane-1,3-diamine |
| PubChem CID | 174966617 |
| Molecular Formula | C9H29N5 |
| Molecular Weight | 207.37 g/mol |
| Exact Mass | 207.24 |
| IUPAC Name | azane;butane-1,3-diamine;pentane-1,3-diamine |
| SMILES | CC(N)CCN.CCC(N)CCN.N |
| InChI | InChI=1S/C5H14N2.C4H12N2.H3N/c1-2-5(7)3-4-6;1-4(6)2-3-5;/h5H,2-4,6-7H2,1H3;4H,2-3,5-6H2,1H3;1H3 |
| InChIKey | JBGMORHLJLPTHW-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;butane-1,3-diamine;pentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;butane-1,3-diamine;pentane-1,3-diamine?
The IUPAC name of azane;butane-1,3-diamine;pentane-1,3-diamine (CID 174966617) is azane;butane-1,3-diamine;pentane-1,3-diamine.
What is the SMILES notation for azane;butane-1,3-diamine;pentane-1,3-diamine?
The canonical SMILES for azane;butane-1,3-diamine;pentane-1,3-diamine is CC(N)CCN.CCC(N)CCN.N.
What is the InChIKey of azane;butane-1,3-diamine;pentane-1,3-diamine?
The InChIKey is JBGMORHLJLPTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2.C4H12N2.H3N/c1-2-5(7)3-4-6;1-4(6)2-3-5;/h5H,2-4,6-7H2,1H3;4H,2-3,5-6H2,1H3;1H3.
What are the key properties of azane;butane-1,3-diamine;pentane-1,3-diamine?
azane;butane-1,3-diamine;pentane-1,3-diamine has a molecular weight of 207.37 g/mol, XLogP of -0.08, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;butane-1,3-diamine;pentane-1,3-diamine is sourced from PubChem (CID 174966617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).