About acetonitrile;2-fluorophenol
acetonitrile;2-fluorophenol (PubChem CID 174966962) has the molecular formula C8H8FNO
and a molecular weight of 153.16 g/mol. Its IUPAC name is acetonitrile;2-fluorophenol.
Molecular Properties
| Compound Name | acetonitrile;2-fluorophenol |
| PubChem CID | 174966962 |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | acetonitrile;2-fluorophenol |
| SMILES | CC#N.Oc1ccccc1F |
| InChI | InChI=1S/C6H5FO.C2H3N/c7-5-3-1-2-4-6(5)8;1-2-3/h1-4,8H;1H3 |
| InChIKey | JGPNOBJFQCPJRN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;2-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-fluorophenol?
The IUPAC name of acetonitrile;2-fluorophenol (CID 174966962) is acetonitrile;2-fluorophenol.
What is the SMILES notation for acetonitrile;2-fluorophenol?
The canonical SMILES for acetonitrile;2-fluorophenol is CC#N.Oc1ccccc1F.
What is the InChIKey of acetonitrile;2-fluorophenol?
The InChIKey is JGPNOBJFQCPJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO.C2H3N/c7-5-3-1-2-4-6(5)8;1-2-3/h1-4,8H;1H3.
What are the key properties of acetonitrile;2-fluorophenol?
acetonitrile;2-fluorophenol has a molecular weight of 153.16 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-fluorophenol is sourced from PubChem (CID 174966962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).