About phenol;2,2,2-trifluoroethoxybenzene
phenol;2,2,2-trifluoroethoxybenzene (PubChem CID 174967121) has the molecular formula C14H13F3O2
and a molecular weight of 270.25 g/mol. Its IUPAC name is phenol;2,2,2-trifluoroethoxybenzene.
Molecular Properties
| Compound Name | phenol;2,2,2-trifluoroethoxybenzene |
| PubChem CID | 174967121 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | phenol;2,2,2-trifluoroethoxybenzene |
| SMILES | FC(F)(F)COc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C8H7F3O.C6H6O/c9-8(10,11)6-12-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5H,6H2;1-5,7H |
| InChIKey | PCHIKHFUERAGDU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenol;2,2,2-trifluoroethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;2,2,2-trifluoroethoxybenzene?
The IUPAC name of phenol;2,2,2-trifluoroethoxybenzene (CID 174967121) is phenol;2,2,2-trifluoroethoxybenzene.
What is the SMILES notation for phenol;2,2,2-trifluoroethoxybenzene?
The canonical SMILES for phenol;2,2,2-trifluoroethoxybenzene is FC(F)(F)COc1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;2,2,2-trifluoroethoxybenzene?
The InChIKey is PCHIKHFUERAGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O.C6H6O/c9-8(10,11)6-12-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5H,6H2;1-5,7H.
What are the key properties of phenol;2,2,2-trifluoroethoxybenzene?
phenol;2,2,2-trifluoroethoxybenzene has a molecular weight of 270.25 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;2,2,2-trifluoroethoxybenzene is sourced from PubChem (CID 174967121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).