About gallane;3-methyl-1-(3-methylbutoxy)butane
gallane;3-methyl-1-(3-methylbutoxy)butane (PubChem CID 174967258) has the molecular formula C10H25GaO
and a molecular weight of 231.03 g/mol. Its IUPAC name is gallane;3-methyl-1-(3-methylbutoxy)butane.
Molecular Properties
| Compound Name | gallane;3-methyl-1-(3-methylbutoxy)butane |
| PubChem CID | 174967258 |
| Molecular Formula | C10H25GaO |
| Molecular Weight | 231.03 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | gallane;3-methyl-1-(3-methylbutoxy)butane |
| SMILES | CC(C)CCOCCC(C)C.[GaH3] |
| InChI | InChI=1S/C10H22O.Ga.3H/c1-9(2)5-7-11-8-6-10(3)4;;;;/h9-10H,5-8H2,1-4H3;;;; |
| InChIKey | KGADOVHNPCDTSH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.03 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze gallane;3-methyl-1-(3-methylbutoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gallane;3-methyl-1-(3-methylbutoxy)butane?
The IUPAC name of gallane;3-methyl-1-(3-methylbutoxy)butane (CID 174967258) is gallane;3-methyl-1-(3-methylbutoxy)butane.
What is the SMILES notation for gallane;3-methyl-1-(3-methylbutoxy)butane?
The canonical SMILES for gallane;3-methyl-1-(3-methylbutoxy)butane is CC(C)CCOCCC(C)C.[GaH3].
What is the InChIKey of gallane;3-methyl-1-(3-methylbutoxy)butane?
The InChIKey is KGADOVHNPCDTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.Ga.3H/c1-9(2)5-7-11-8-6-10(3)4;;;;/h9-10H,5-8H2,1-4H3;;;;.
What are the key properties of gallane;3-methyl-1-(3-methylbutoxy)butane?
gallane;3-methyl-1-(3-methylbutoxy)butane has a molecular weight of 231.03 g/mol, XLogP of 1.91, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for gallane;3-methyl-1-(3-methylbutoxy)butane is sourced from PubChem (CID 174967258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).