C16H12F3NO6S2 — CID 174969336
2-(benzenesulfonyl)-6-(2,2,2-trifluoroethoxy)-1H-indole-3-sulfonic acid (PubChem CID 174969336) has the molecular formula C16H12F3NO6S2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-6-(2,2,2-trifluoroethoxy)-1H-indole-3-sulfonic acid.
| Compound Name | 2-(benzenesulfonyl)-6-(2,2,2-trifluoroethoxy)-1H-indole-3-sulfonic acid |
|---|---|
| PubChem CID | 174969336 |
| Molecular Formula | C16H12F3NO6S2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-(benzenesulfonyl)-6-(2,2,2-trifluoroethoxy)-1H-indole-3-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(S(=O)(=O)c2ccccc2)[nH]c2cc(OCC(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H12F3NO6S2/c17-16(18,19)9-26-10-6-7-12-13(8-10)20-15(14(12)28(23,24)25)27(21,22)11-4-2-1-3-5-11/h1-8,20H,9H2,(H,23,24,25) |
| InChIKey | QZOXXTJJCMTINK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|