About benzene-1,3-diol;4-phenyltriazine
benzene-1,3-diol;4-phenyltriazine (PubChem CID 174969661) has the molecular formula C15H13N3O2
and a molecular weight of 267.29 g/mol. Its IUPAC name is benzene-1,3-diol;4-phenyltriazine.
Molecular Properties
| Compound Name | benzene-1,3-diol;4-phenyltriazine |
| PubChem CID | 174969661 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | benzene-1,3-diol;4-phenyltriazine |
| SMILES | Oc1cccc(O)c1.c1ccc(-c2ccnnn2)cc1 |
| InChI | InChI=1S/C9H7N3.C6H6O2/c1-2-4-8(5-3-1)9-6-7-10-12-11-9;7-5-2-1-3-6(8)4-5/h1-7H;1-4,7-8H |
| InChIKey | HGRRBNDCJHJALQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzene-1,3-diol;4-phenyltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;4-phenyltriazine?
The IUPAC name of benzene-1,3-diol;4-phenyltriazine (CID 174969661) is benzene-1,3-diol;4-phenyltriazine.
What is the SMILES notation for benzene-1,3-diol;4-phenyltriazine?
The canonical SMILES for benzene-1,3-diol;4-phenyltriazine is Oc1cccc(O)c1.c1ccc(-c2ccnnn2)cc1.
What is the InChIKey of benzene-1,3-diol;4-phenyltriazine?
The InChIKey is HGRRBNDCJHJALQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3.C6H6O2/c1-2-4-8(5-3-1)9-6-7-10-12-11-9;7-5-2-1-3-6(8)4-5/h1-7H;1-4,7-8H.
What are the key properties of benzene-1,3-diol;4-phenyltriazine?
benzene-1,3-diol;4-phenyltriazine has a molecular weight of 267.29 g/mol, XLogP of 2.64, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;4-phenyltriazine is sourced from PubChem (CID 174969661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).