About O-pentyl carbamothioate;phosphenous acid
O-pentyl carbamothioate;phosphenous acid (PubChem CID 174969907) has the molecular formula C6H14NO3PS
and a molecular weight of 211.22 g/mol. Its IUPAC name is O-pentyl carbamothioate;phosphenous acid.
Molecular Properties
| Compound Name | O-pentyl carbamothioate;phosphenous acid |
| PubChem CID | 174969907 |
| Molecular Formula | C6H14NO3PS |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | O-pentyl carbamothioate;phosphenous acid |
| SMILES | CCCCCOC(N)=S.O=PO |
| InChI | InChI=1S/C6H13NOS.HO2P/c1-2-3-4-5-8-6(7)9;1-3-2/h2-5H2,1H3,(H2,7,9);(H,1,2) |
| InChIKey | QSXUEDOTOZIMQE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-pentyl carbamothioate;phosphenous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-pentyl carbamothioate;phosphenous acid?
The IUPAC name of O-pentyl carbamothioate;phosphenous acid (CID 174969907) is O-pentyl carbamothioate;phosphenous acid.
What is the SMILES notation for O-pentyl carbamothioate;phosphenous acid?
The canonical SMILES for O-pentyl carbamothioate;phosphenous acid is CCCCCOC(N)=S.O=PO.
What is the InChIKey of O-pentyl carbamothioate;phosphenous acid?
The InChIKey is QSXUEDOTOZIMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NOS.HO2P/c1-2-3-4-5-8-6(7)9;1-3-2/h2-5H2,1H3,(H2,7,9);(H,1,2).
What are the key properties of O-pentyl carbamothioate;phosphenous acid?
O-pentyl carbamothioate;phosphenous acid has a molecular weight of 211.22 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-pentyl carbamothioate;phosphenous acid is sourced from PubChem (CID 174969907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).