About [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate
[4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate (PubChem CID 174970057) has the molecular formula C16H23IN2O4
and a molecular weight of 434.27 g/mol. Its IUPAC name is [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate |
| PubChem CID | 174970057 |
| Molecular Formula | C16H23IN2O4 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1(CNC(=O)c2ccoc2I)CCNCC1 |
| InChI | InChI=1S/C16H23IN2O4/c1-15(2,3)14(21)23-16(5-7-18-8-6-16)10-19-13(20)11-4-9-22-12(11)17/h4,9,18H,5-8,10H2,1-3H3,(H,19,20) |
| InChIKey | GTFPKIPIUULXND-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate?
The IUPAC name of [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate (CID 174970057) is [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC1(CNC(=O)c2ccoc2I)CCNCC1.
What is the InChIKey of [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate?
The InChIKey is GTFPKIPIUULXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23IN2O4/c1-15(2,3)14(21)23-16(5-7-18-8-6-16)10-19-13(20)11-4-9-22-12(11)17/h4,9,18H,5-8,10H2,1-3H3,(H,19,20).
What are the key properties of [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate?
[4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate has a molecular weight of 434.27 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(2-iodofuran-3-carbonyl)amino]methyl]piperidin-4-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174970057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).