C17H13ClFN3O — CID 174970215
5-amino-2-chloro-N-(2-cyano-4-fluorophenyl)-3-prop-2-enylbenzamide (PubChem CID 174970215) has the molecular formula C17H13ClFN3O and a molecular weight of 329.76 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(2-cyano-4-fluorophenyl)-3-prop-2-enylbenzamide.
| Compound Name | 5-amino-2-chloro-N-(2-cyano-4-fluorophenyl)-3-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 174970215 |
| Molecular Formula | C17H13ClFN3O |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-amino-2-chloro-N-(2-cyano-4-fluorophenyl)-3-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(N)cc(C(=O)Nc2ccc(F)cc2C#N)c1Cl |
| InChI | InChI=1S/C17H13ClFN3O/c1-2-3-10-7-13(21)8-14(16(10)18)17(23)22-15-5-4-12(19)6-11(15)9-20/h2,4-8H,1,3,21H2,(H,22,23) |
| InChIKey | JTTLJEUROMZLAU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|