About (3-bromophenyl)boronic acid;pyridine
(3-bromophenyl)boronic acid;pyridine (PubChem CID 174970382) has the molecular formula C11H11BBrNO2
and a molecular weight of 279.93 g/mol. Its IUPAC name is (3-bromophenyl)boronic acid;pyridine.
Molecular Properties
| Compound Name | (3-bromophenyl)boronic acid;pyridine |
| PubChem CID | 174970382 |
| Molecular Formula | C11H11BBrNO2 |
| Molecular Weight | 279.93 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | (3-bromophenyl)boronic acid;pyridine |
| SMILES | OB(O)c1cccc(Br)c1.c1ccncc1 |
| InChI | InChI=1S/C6H6BBrO2.C5H5N/c8-6-3-1-2-5(4-6)7(9)10;1-2-4-6-5-3-1/h1-4,9-10H;1-5H |
| InChIKey | HLUWQKJMFQTAEZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.93 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl)boronic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)boronic acid;pyridine?
The IUPAC name of (3-bromophenyl)boronic acid;pyridine (CID 174970382) is (3-bromophenyl)boronic acid;pyridine.
What is the SMILES notation for (3-bromophenyl)boronic acid;pyridine?
The canonical SMILES for (3-bromophenyl)boronic acid;pyridine is OB(O)c1cccc(Br)c1.c1ccncc1.
What is the InChIKey of (3-bromophenyl)boronic acid;pyridine?
The InChIKey is HLUWQKJMFQTAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BBrO2.C5H5N/c8-6-3-1-2-5(4-6)7(9)10;1-2-4-6-5-3-1/h1-4,9-10H;1-5H.
What are the key properties of (3-bromophenyl)boronic acid;pyridine?
(3-bromophenyl)boronic acid;pyridine has a molecular weight of 279.93 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)boronic acid;pyridine is sourced from PubChem (CID 174970382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).