About ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane
ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane (PubChem CID 174970780) has the molecular formula C13H36O6Si2
and a molecular weight of 344.60 g/mol. Its IUPAC name is ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane.
Molecular Properties
| Compound Name | ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane |
| PubChem CID | 174970780 |
| Molecular Formula | C13H36O6Si2 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane |
| SMILES | CC.CCO[Si](C)(OCC)OCC.CO[Si](C)(OC)OC |
| InChI | InChI=1S/C7H18O3Si.C4H12O3Si.C2H6/c1-5-8-11(4,9-6-2)10-7-3;1-5-8(4,6-2)7-3;1-2/h5-7H2,1-4H3;1-4H3;1-2H3 |
| InChIKey | WTCOYVFEWGLCJG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane?
The IUPAC name of ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane (CID 174970780) is ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane.
What is the SMILES notation for ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane?
The canonical SMILES for ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane is CC.CCO[Si](C)(OCC)OCC.CO[Si](C)(OC)OC.
What is the InChIKey of ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane?
The InChIKey is WTCOYVFEWGLCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O3Si.C4H12O3Si.C2H6/c1-5-8-11(4,9-6-2)10-7-3;1-5-8(4,6-2)7-3;1-2/h5-7H2,1-4H3;1-4H3;1-2H3.
What are the key properties of ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane?
ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane has a molecular weight of 344.60 g/mol, XLogP of 3.19, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;triethoxy(methyl)silane;trimethoxy(methyl)silane is sourced from PubChem (CID 174970780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).