About 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium
2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium (PubChem CID 174971310) has the molecular formula C10H12O2Ru
and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium.
Molecular Properties
| Compound Name | 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium |
| PubChem CID | 174971310 |
| Molecular Formula | C10H12O2Ru |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium |
| SMILES | CC(C)(C)C1=CC(=O)C=CC1=O.[Ru] |
| InChI | InChI=1S/C10H12O2.Ru/c1-10(2,3)8-6-7(11)4-5-9(8)12;/h4-6H,1-3H3; |
| InChIKey | HNFJZJXFSWOJRC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium?
The IUPAC name of 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium (CID 174971310) is 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium.
What is the SMILES notation for 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium?
The canonical SMILES for 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium is CC(C)(C)C1=CC(=O)C=CC1=O.[Ru].
What is the InChIKey of 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium?
The InChIKey is HNFJZJXFSWOJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.Ru/c1-10(2,3)8-6-7(11)4-5-9(8)12;/h4-6H,1-3H3;.
What are the key properties of 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium?
2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium has a molecular weight of 265.27 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylcyclohexa-2,5-diene-1,4-dione;ruthenium is sourced from PubChem (CID 174971310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).