C11H26Cl2N2O5 — CID 174971818
1-amino-1-piperidin-4-ylhexane-1,2,3,4,5-pentol;dihydrochloride (PubChem CID 174971818) has the molecular formula C11H26Cl2N2O5 and a molecular weight of 337.24 g/mol. Its IUPAC name is 1-amino-1-piperidin-4-ylhexane-1,2,3,4,5-pentol;dihydrochloride.
| Compound Name | 1-amino-1-piperidin-4-ylhexane-1,2,3,4,5-pentol;dihydrochloride |
|---|---|
| PubChem CID | 174971818 |
| Molecular Formula | C11H26Cl2N2O5 |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-amino-1-piperidin-4-ylhexane-1,2,3,4,5-pentol;dihydrochloride |
| SMILES | CC(O)C(O)C(O)C(O)C(N)(O)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C11H24N2O5.2ClH/c1-6(14)8(15)9(16)10(17)11(12,18)7-2-4-13-5-3-7;;/h6-10,13-18H,2-5,12H2,1H3;2*1H |
| InChIKey | QANMHMXVBJDWQL-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|