C20H26N2O2S — CID 17497186
N-[3-[2,6-di(propan-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 17497186) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[3-[2,6-di(propan-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[2,6-di(propan-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17497186 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[3-[2,6-di(propan-2-yl)anilino]-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CCNC(=O)c1cccs1 |
| InChI | InChI=1S/C20H26N2O2S/c1-13(2)15-7-5-8-16(14(3)4)19(15)22-18(23)10-11-21-20(24)17-9-6-12-25-17/h5-9,12-14H,10-11H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | PFGVOXXPFXGWON-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |