About 1,1-difluoroethene;ethenyl thiohypofluorite
1,1-difluoroethene;ethenyl thiohypofluorite (PubChem CID 174972129) has the molecular formula C4H5F3S
and a molecular weight of 142.14 g/mol. Its IUPAC name is 1,1-difluoroethene;ethenyl thiohypofluorite.
Molecular Properties
| Compound Name | 1,1-difluoroethene;ethenyl thiohypofluorite |
| PubChem CID | 174972129 |
| Molecular Formula | C4H5F3S |
| Molecular Weight | 142.14 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | 1,1-difluoroethene;ethenyl thiohypofluorite |
| SMILES | C=C(F)F.C=CSF |
| InChI | InChI=1S/C2H2F2.C2H3FS/c1-2(3)4;1-2-4-3/h1H2;2H,1H2 |
| InChIKey | NNMLLBVXBGNUKC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.14 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-difluoroethene;ethenyl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethene;ethenyl thiohypofluorite?
The IUPAC name of 1,1-difluoroethene;ethenyl thiohypofluorite (CID 174972129) is 1,1-difluoroethene;ethenyl thiohypofluorite.
What is the SMILES notation for 1,1-difluoroethene;ethenyl thiohypofluorite?
The canonical SMILES for 1,1-difluoroethene;ethenyl thiohypofluorite is C=C(F)F.C=CSF.
What is the InChIKey of 1,1-difluoroethene;ethenyl thiohypofluorite?
The InChIKey is NNMLLBVXBGNUKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F2.C2H3FS/c1-2(3)4;1-2-4-3/h1H2;2H,1H2.
What are the key properties of 1,1-difluoroethene;ethenyl thiohypofluorite?
1,1-difluoroethene;ethenyl thiohypofluorite has a molecular weight of 142.14 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethene;ethenyl thiohypofluorite is sourced from PubChem (CID 174972129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).