C8H15F3N2 — CID 174972427
2-ethyl-1-(1,2,2-trifluoroethyl)piperazine (PubChem CID 174972427) has the molecular formula C8H15F3N2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 2-ethyl-1-(1,2,2-trifluoroethyl)piperazine.
| Compound Name | 2-ethyl-1-(1,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 174972427 |
| Molecular Formula | C8H15F3N2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-ethyl-1-(1,2,2-trifluoroethyl)piperazine |
| SMILES | CCC1CNCCN1C(F)C(F)F |
| InChI | InChI=1S/C8H15F3N2/c1-2-6-5-12-3-4-13(6)8(11)7(9)10/h6-8,12H,2-5H2,1H3 |
| InChIKey | MYYODOBCJQMNCJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|