About N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine
N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine (PubChem CID 174972661) has the molecular formula C8H15N5S
and a molecular weight of 213.31 g/mol. Its IUPAC name is N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine.
Molecular Properties
| Compound Name | N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine |
| PubChem CID | 174972661 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine |
| SMILES | Cc1nc(N)nc(N(S)C(C)(C)C)n1 |
| InChI | InChI=1S/C8H15N5S/c1-5-10-6(9)12-7(11-5)13(14)8(2,3)4/h14H,1-4H3,(H2,9,10,11,12) |
| InChIKey | HMTDVNRJHPMJRC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine?
The IUPAC name of N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine (CID 174972661) is N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine.
What is the SMILES notation for N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine?
The canonical SMILES for N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine is Cc1nc(N)nc(N(S)C(C)(C)C)n1.
What is the InChIKey of N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine?
The InChIKey is HMTDVNRJHPMJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5S/c1-5-10-6(9)12-7(11-5)13(14)8(2,3)4/h14H,1-4H3,(H2,9,10,11,12).
What are the key properties of N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine?
N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine has a molecular weight of 213.31 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-6-methyl-1,3,5-triazin-2-yl)-N-tert-butylthiohydroxylamine is sourced from PubChem (CID 174972661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).