About boric acid;phenol;(phenyldisulfanyl)benzene
boric acid;phenol;(phenyldisulfanyl)benzene (PubChem CID 174972963) has the molecular formula C18H19BO4S2
and a molecular weight of 374.29 g/mol. Its IUPAC name is boric acid;phenol;(phenyldisulfanyl)benzene.
Molecular Properties
| Compound Name | boric acid;phenol;(phenyldisulfanyl)benzene |
| PubChem CID | 174972963 |
| Molecular Formula | C18H19BO4S2 |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | boric acid;phenol;(phenyldisulfanyl)benzene |
| SMILES | OB(O)O.Oc1ccccc1.c1ccc(SSc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S2.C6H6O.BH3O3/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;2-1(3)4/h1-10H;1-5,7H;2-4H |
| InChIKey | CICUZODDRVNMRA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;phenol;(phenyldisulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;phenol;(phenyldisulfanyl)benzene?
The IUPAC name of boric acid;phenol;(phenyldisulfanyl)benzene (CID 174972963) is boric acid;phenol;(phenyldisulfanyl)benzene.
What is the SMILES notation for boric acid;phenol;(phenyldisulfanyl)benzene?
The canonical SMILES for boric acid;phenol;(phenyldisulfanyl)benzene is OB(O)O.Oc1ccccc1.c1ccc(SSc2ccccc2)cc1.
What is the InChIKey of boric acid;phenol;(phenyldisulfanyl)benzene?
The InChIKey is CICUZODDRVNMRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S2.C6H6O.BH3O3/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;2-1(3)4/h1-10H;1-5,7H;2-4H.
What are the key properties of boric acid;phenol;(phenyldisulfanyl)benzene?
boric acid;phenol;(phenyldisulfanyl)benzene has a molecular weight of 374.29 g/mol, XLogP of 3.83, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;phenol;(phenyldisulfanyl)benzene is sourced from PubChem (CID 174972963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).