About 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene
2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene (PubChem CID 174973314) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 174973314 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene |
| SMILES | C=CC(C)C(C)C(C)C1=CC2CCC1C2 |
| InChI | InChI=1S/C15H24/c1-5-10(2)11(3)12(4)15-9-13-6-7-14(15)8-13/h5,9-14H,1,6-8H2,2-4H3 |
| InChIKey | XCBXFRDXPRHDFN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene?
The IUPAC name of 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene (CID 174973314) is 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene is C=CC(C)C(C)C(C)C1=CC2CCC1C2.
What is the InChIKey of 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene?
The InChIKey is XCBXFRDXPRHDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24/c1-5-10(2)11(3)12(4)15-9-13-6-7-14(15)8-13/h5,9-14H,1,6-8H2,2-4H3.
What are the key properties of 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene?
2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene has a molecular weight of 204.36 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylhex-5-en-2-yl)bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 174973314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).