About 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde
2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde (PubChem CID 174974265) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde |
| PubChem CID | 174974265 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde |
| SMILES | CC(C)c1ncoc1C(=O)C=O |
| InChI | InChI=1S/C8H9NO3/c1-5(2)7-8(6(11)3-10)12-4-9-7/h3-5H,1-2H3 |
| InChIKey | IRYNIXKZOXMRIS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde?
The IUPAC name of 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde (CID 174974265) is 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde.
What is the SMILES notation for 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde?
The canonical SMILES for 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde is CC(C)c1ncoc1C(=O)C=O.
What is the InChIKey of 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde?
The InChIKey is IRYNIXKZOXMRIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-5(2)7-8(6(11)3-10)12-4-9-7/h3-5H,1-2H3.
What are the key properties of 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde?
2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde has a molecular weight of 167.16 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-(4-propan-2-yl-1,3-oxazol-5-yl)acetaldehyde is sourced from PubChem (CID 174974265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).