About formonitrile;5-methylpyridin-2-amine
formonitrile;5-methylpyridin-2-amine (PubChem CID 174974730) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is formonitrile;5-methylpyridin-2-amine.
Molecular Properties
| Compound Name | formonitrile;5-methylpyridin-2-amine |
| PubChem CID | 174974730 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | formonitrile;5-methylpyridin-2-amine |
| SMILES | C#N.Cc1ccc(N)nc1 |
| InChI | InChI=1S/C6H8N2.CHN/c1-5-2-3-6(7)8-4-5;1-2/h2-4H,1H3,(H2,7,8);1H |
| InChIKey | GGEAAYRXBQNKFU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formonitrile;5-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;5-methylpyridin-2-amine?
The IUPAC name of formonitrile;5-methylpyridin-2-amine (CID 174974730) is formonitrile;5-methylpyridin-2-amine.
What is the SMILES notation for formonitrile;5-methylpyridin-2-amine?
The canonical SMILES for formonitrile;5-methylpyridin-2-amine is C#N.Cc1ccc(N)nc1.
What is the InChIKey of formonitrile;5-methylpyridin-2-amine?
The InChIKey is GGEAAYRXBQNKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.CHN/c1-5-2-3-6(7)8-4-5;1-2/h2-4H,1H3,(H2,7,8);1H.
What are the key properties of formonitrile;5-methylpyridin-2-amine?
formonitrile;5-methylpyridin-2-amine has a molecular weight of 135.17 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;5-methylpyridin-2-amine is sourced from PubChem (CID 174974730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).