C21H20Cl2FNO4 — CID 174975371
dichloromethane;1-(4-fluorophenyl)-5-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentane-1,5-dione (PubChem CID 174975371) has the molecular formula C21H20Cl2FNO4 and a molecular weight of 440.30 g/mol. Its IUPAC name is dichloromethane;1-(4-fluorophenyl)-5-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentane-1,5-dione.
| Compound Name | dichloromethane;1-(4-fluorophenyl)-5-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentane-1,5-dione |
|---|---|
| PubChem CID | 174975371 |
| Molecular Formula | C21H20Cl2FNO4 |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | dichloromethane;1-(4-fluorophenyl)-5-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]pentane-1,5-dione |
| SMILES | ClCCl.O=C(CCCC(=O)N1C(=O)OC[C@@H]1c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18FNO4.CH2Cl2/c21-16-11-9-15(10-12-16)18(23)7-4-8-19(24)22-17(13-26-20(22)25)14-5-2-1-3-6-14;2-1-3/h1-3,5-6,9-12,17H,4,7-8,13H2;1H2/t17-;/m1./s1 |
| InChIKey | ZFDJWEAYDGQHRT-UNTBIKODSA-N |
| XLogP | 5.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|