About 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine
1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine (PubChem CID 174975761) has the molecular formula C24H26N2Si2
and a molecular weight of 398.66 g/mol. Its IUPAC name is 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine.
Molecular Properties
| Compound Name | 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine |
| PubChem CID | 174975761 |
| Molecular Formula | C24H26N2Si2 |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine |
| SMILES | [H]/N=C1\c2ccccc2/C(=N\[H])c2c1ccc(C#C[Si](C)(C)C)c2C#C[Si](C)(C)C |
| InChI | InChI=1S/C24H26N2Si2/c1-27(2,3)15-13-17-11-12-21-22(18(17)14-16-28(4,5)6)24(26)20-10-8-7-9-19(20)23(21)25/h7-12,25-26H,1-6H3/b25-23+,26-24+ |
| InChIKey | CIAJBGFVIIDUPK-OGGGYYITSA-N |
| XLogP | 5.29 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine?
The IUPAC name of 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine (CID 174975761) is 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine.
What is the SMILES notation for 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine?
The canonical SMILES for 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine is [H]/N=C1\c2ccccc2/C(=N\[H])c2c1ccc(C#C[Si](C)(C)C)c2C#C[Si](C)(C)C.
What is the InChIKey of 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine?
The InChIKey is CIAJBGFVIIDUPK-OGGGYYITSA-N. The full InChI is InChI=1S/C24H26N2Si2/c1-27(2,3)15-13-17-11-12-21-22(18(17)14-16-28(4,5)6)24(26)20-10-8-7-9-19(20)23(21)25/h7-12,25-26H,1-6H3/b25-23+,26-24+.
What are the key properties of 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine?
1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine has a molecular weight of 398.66 g/mol, XLogP of 5.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(2-trimethylsilylethynyl)anthracene-9,10-diimine is sourced from PubChem (CID 174975761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).