C15H22N2O2 — CID 174976344
1-[1-amino-4-(4-aminohepta-1,6-dien-4-yloxy)cyclohexa-2,4-dien-1-yl]ethanone (PubChem CID 174976344) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[1-amino-4-(4-aminohepta-1,6-dien-4-yloxy)cyclohexa-2,4-dien-1-yl]ethanone.
| Compound Name | 1-[1-amino-4-(4-aminohepta-1,6-dien-4-yloxy)cyclohexa-2,4-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 174976344 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[1-amino-4-(4-aminohepta-1,6-dien-4-yloxy)cyclohexa-2,4-dien-1-yl]ethanone |
| SMILES | C=CCC(N)(CC=C)OC1=CCC(N)(C(C)=O)C=C1 |
| InChI | InChI=1S/C15H22N2O2/c1-4-8-15(17,9-5-2)19-13-6-10-14(16,11-7-13)12(3)18/h4-7,10H,1-2,8-9,11,16-17H2,3H3 |
| InChIKey | WQXHFLORCYGPMG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|