About dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride
dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride (PubChem CID 174976589) has the molecular formula C12H22ClNO2
and a molecular weight of 247.77 g/mol. Its IUPAC name is dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride.
Molecular Properties
| Compound Name | dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride |
| PubChem CID | 174976589 |
| Molecular Formula | C12H22ClNO2 |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride |
| SMILES | C=C(C)C(=O)O.C=CC[N+](C)(C)CC=C.[Cl-] |
| InChI | InChI=1S/C8H16N.C4H6O2.ClH/c1-5-7-9(3,4)8-6-2;1-3(2)4(5)6;/h5-6H,1-2,7-8H2,3-4H3;1H2,2H3,(H,5,6);1H/q+1;;/p-1 |
| InChIKey | JCRSETVAKNMXOR-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride?
The IUPAC name of dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride (CID 174976589) is dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride.
What is the SMILES notation for dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride?
The canonical SMILES for dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride is C=C(C)C(=O)O.C=CC[N+](C)(C)CC=C.[Cl-].
What is the InChIKey of dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride?
The InChIKey is JCRSETVAKNMXOR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N.C4H6O2.ClH/c1-5-7-9(3,4)8-6-2;1-3(2)4(5)6;/h5-6H,1-2,7-8H2,3-4H3;1H2,2H3,(H,5,6);1H/q+1;;/p-1.
What are the key properties of dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride?
dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride has a molecular weight of 247.77 g/mol, XLogP of -0.91, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(prop-2-enyl)azanium;2-methylprop-2-enoic acid;chloride is sourced from PubChem (CID 174976589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).