C13H6O5 — CID 174976881
2-(3,6-dioxocyclohexa-1,4-diene-1-carbonyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 174976881) has the molecular formula C13H6O5 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2-(3,6-dioxocyclohexa-1,4-diene-1-carbonyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3,6-dioxocyclohexa-1,4-diene-1-carbonyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 174976881 |
| Molecular Formula | C13H6O5 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-(3,6-dioxocyclohexa-1,4-diene-1-carbonyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(C(=O)C2=CC(=O)C=CC2=O)=C1 |
| InChI | InChI=1S/C13H6O5/c14-7-1-3-11(16)9(5-7)13(18)10-6-8(15)2-4-12(10)17/h1-6H |
| InChIKey | PUHWSIFJSFOWPO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|