About N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane
N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane (PubChem CID 174977414) has the molecular formula C9H22F3NS
and a molecular weight of 233.34 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane |
| PubChem CID | 174977414 |
| Molecular Formula | C9H22F3NS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane |
| SMILES | CCN(C(C)C)C(C)C.CS(F)(F)F |
| InChI | InChI=1S/C8H19N.CH3F3S/c1-6-9(7(2)3)8(4)5;1-5(2,3)4/h7-8H,6H2,1-5H3;1H3 |
| InChIKey | BSRACZSCUMZNHM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane?
The IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane (CID 174977414) is N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane.
What is the SMILES notation for N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane?
The canonical SMILES for N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane is CCN(C(C)C)C(C)C.CS(F)(F)F.
What is the InChIKey of N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane?
The InChIKey is BSRACZSCUMZNHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.CH3F3S/c1-6-9(7(2)3)8(4)5;1-5(2,3)4/h7-8H,6H2,1-5H3;1H3.
What are the key properties of N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane?
N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane has a molecular weight of 233.34 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylpropan-2-amine;trifluoro(methyl)-λ4-sulfane is sourced from PubChem (CID 174977414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).