About 2-chloronaphthalene-1,4-dione;sulfane
2-chloronaphthalene-1,4-dione;sulfane (PubChem CID 174978325) has the molecular formula C10H7ClO2S
and a molecular weight of 226.68 g/mol. Its IUPAC name is 2-chloronaphthalene-1,4-dione;sulfane.
Molecular Properties
| Compound Name | 2-chloronaphthalene-1,4-dione;sulfane |
| PubChem CID | 174978325 |
| Molecular Formula | C10H7ClO2S |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 2-chloronaphthalene-1,4-dione;sulfane |
| SMILES | O=C1C=C(Cl)C(=O)c2ccccc21.S |
| InChI | InChI=1S/C10H5ClO2.H2S/c11-8-5-9(12)6-3-1-2-4-7(6)10(8)13;/h1-5H;1H2 |
| InChIKey | SINVKOKVLQFMPL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-chloronaphthalene-1,4-dione;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloronaphthalene-1,4-dione;sulfane?
The IUPAC name of 2-chloronaphthalene-1,4-dione;sulfane (CID 174978325) is 2-chloronaphthalene-1,4-dione;sulfane.
What is the SMILES notation for 2-chloronaphthalene-1,4-dione;sulfane?
The canonical SMILES for 2-chloronaphthalene-1,4-dione;sulfane is O=C1C=C(Cl)C(=O)c2ccccc21.S.
What is the InChIKey of 2-chloronaphthalene-1,4-dione;sulfane?
The InChIKey is SINVKOKVLQFMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClO2.H2S/c11-8-5-9(12)6-3-1-2-4-7(6)10(8)13;/h1-5H;1H2.
What are the key properties of 2-chloronaphthalene-1,4-dione;sulfane?
2-chloronaphthalene-1,4-dione;sulfane has a molecular weight of 226.68 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloronaphthalene-1,4-dione;sulfane is sourced from PubChem (CID 174978325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).