About bismuthane;porphyrin
bismuthane;porphyrin (PubChem CID 174978505) has the molecular formula C20H15BiN4
and a molecular weight of 520.35 g/mol. Its IUPAC name is bismuthane;porphyrin.
Molecular Properties
| Compound Name | bismuthane;porphyrin |
| PubChem CID | 174978505 |
| Molecular Formula | C20H15BiN4 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | bismuthane;porphyrin |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[BiH3] |
| InChI | InChI=1S/C20H12N4.Bi.3H/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;;;/h1-12H;;;;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;;; |
| InChIKey | DLVMMGNWEDOASM-YCWHZZGXSA-N |
| XLogP | 2.39 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bismuthane;porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bismuthane;porphyrin?
The IUPAC name of bismuthane;porphyrin (CID 174978505) is bismuthane;porphyrin.
What is the SMILES notation for bismuthane;porphyrin?
The canonical SMILES for bismuthane;porphyrin is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[BiH3].
What is the InChIKey of bismuthane;porphyrin?
The InChIKey is DLVMMGNWEDOASM-YCWHZZGXSA-N. The full InChI is InChI=1S/C20H12N4.Bi.3H/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;;;;/h1-12H;;;;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;;;.
What are the key properties of bismuthane;porphyrin?
bismuthane;porphyrin has a molecular weight of 520.35 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bismuthane;porphyrin is sourced from PubChem (CID 174978505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).