About acetic acid;ethenyl 3-sulfanylpropanoate
acetic acid;ethenyl 3-sulfanylpropanoate (PubChem CID 174979230) has the molecular formula C7H12O4S
and a molecular weight of 192.24 g/mol. Its IUPAC name is acetic acid;ethenyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | acetic acid;ethenyl 3-sulfanylpropanoate |
| PubChem CID | 174979230 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | acetic acid;ethenyl 3-sulfanylpropanoate |
| SMILES | C=COC(=O)CCS.CC(=O)O |
| InChI | InChI=1S/C5H8O2S.C2H4O2/c1-2-7-5(6)3-4-8;1-2(3)4/h2,8H,1,3-4H2;1H3,(H,3,4) |
| InChIKey | GSKIDSLXSMVUOC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;ethenyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethenyl 3-sulfanylpropanoate?
The IUPAC name of acetic acid;ethenyl 3-sulfanylpropanoate (CID 174979230) is acetic acid;ethenyl 3-sulfanylpropanoate.
What is the SMILES notation for acetic acid;ethenyl 3-sulfanylpropanoate?
The canonical SMILES for acetic acid;ethenyl 3-sulfanylpropanoate is C=COC(=O)CCS.CC(=O)O.
What is the InChIKey of acetic acid;ethenyl 3-sulfanylpropanoate?
The InChIKey is GSKIDSLXSMVUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S.C2H4O2/c1-2-7-5(6)3-4-8;1-2(3)4/h2,8H,1,3-4H2;1H3,(H,3,4).
What are the key properties of acetic acid;ethenyl 3-sulfanylpropanoate?
acetic acid;ethenyl 3-sulfanylpropanoate has a molecular weight of 192.24 g/mol, XLogP of 1.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethenyl 3-sulfanylpropanoate is sourced from PubChem (CID 174979230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).