About 3,7-dimethylocta-3,6-diene-1,5-diol
3,7-dimethylocta-3,6-diene-1,5-diol (PubChem CID 174979405) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 3,7-dimethylocta-3,6-diene-1,5-diol.
Molecular Properties
| Compound Name | 3,7-dimethylocta-3,6-diene-1,5-diol |
| PubChem CID | 174979405 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3,7-dimethylocta-3,6-diene-1,5-diol |
| SMILES | CC(C)=CC(O)C=C(C)CCO |
| InChI | InChI=1S/C10H18O2/c1-8(2)6-10(12)7-9(3)4-5-11/h6-7,10-12H,4-5H2,1-3H3 |
| InChIKey | ZYSDKYORTZJAIW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethylocta-3,6-diene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethylocta-3,6-diene-1,5-diol?
The IUPAC name of 3,7-dimethylocta-3,6-diene-1,5-diol (CID 174979405) is 3,7-dimethylocta-3,6-diene-1,5-diol.
What is the SMILES notation for 3,7-dimethylocta-3,6-diene-1,5-diol?
The canonical SMILES for 3,7-dimethylocta-3,6-diene-1,5-diol is CC(C)=CC(O)C=C(C)CCO.
What is the InChIKey of 3,7-dimethylocta-3,6-diene-1,5-diol?
The InChIKey is ZYSDKYORTZJAIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-8(2)6-10(12)7-9(3)4-5-11/h6-7,10-12H,4-5H2,1-3H3.
What are the key properties of 3,7-dimethylocta-3,6-diene-1,5-diol?
3,7-dimethylocta-3,6-diene-1,5-diol has a molecular weight of 170.25 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylocta-3,6-diene-1,5-diol is sourced from PubChem (CID 174979405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).