About 2-butyl-3-methylbutanedioic acid;gold
2-butyl-3-methylbutanedioic acid;gold (PubChem CID 174979510) has the molecular formula C9H16Au2O4
and a molecular weight of 582.16 g/mol. Its IUPAC name is 2-butyl-3-methylbutanedioic acid;gold.
Molecular Properties
| Compound Name | 2-butyl-3-methylbutanedioic acid;gold |
| PubChem CID | 174979510 |
| Molecular Formula | C9H16Au2O4 |
| Molecular Weight | 582.16 g/mol |
| Exact Mass | 582.04 |
| IUPAC Name | 2-butyl-3-methylbutanedioic acid;gold |
| SMILES | CCCCC(C(=O)O)C(C)C(=O)O.[Au].[Au] |
| InChI | InChI=1S/C9H16O4.2Au/c1-3-4-5-7(9(12)13)6(2)8(10)11;;/h6-7H,3-5H2,1-2H3,(H,10,11)(H,12,13);; |
| InChIKey | QWNFOELDHQGCCX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 582.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-3-methylbutanedioic acid;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-methylbutanedioic acid;gold?
The IUPAC name of 2-butyl-3-methylbutanedioic acid;gold (CID 174979510) is 2-butyl-3-methylbutanedioic acid;gold.
What is the SMILES notation for 2-butyl-3-methylbutanedioic acid;gold?
The canonical SMILES for 2-butyl-3-methylbutanedioic acid;gold is CCCCC(C(=O)O)C(C)C(=O)O.[Au].[Au].
What is the InChIKey of 2-butyl-3-methylbutanedioic acid;gold?
The InChIKey is QWNFOELDHQGCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.2Au/c1-3-4-5-7(9(12)13)6(2)8(10)11;;/h6-7H,3-5H2,1-2H3,(H,10,11)(H,12,13);;.
What are the key properties of 2-butyl-3-methylbutanedioic acid;gold?
2-butyl-3-methylbutanedioic acid;gold has a molecular weight of 582.16 g/mol, XLogP of 1.59, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-methylbutanedioic acid;gold is sourced from PubChem (CID 174979510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).