About aniline;1,2,2,4-tetramethylquinoline
aniline;1,2,2,4-tetramethylquinoline (PubChem CID 174979716) has the molecular formula C19H24N2
and a molecular weight of 280.42 g/mol. Its IUPAC name is aniline;1,2,2,4-tetramethylquinoline.
Molecular Properties
| Compound Name | aniline;1,2,2,4-tetramethylquinoline |
| PubChem CID | 174979716 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | aniline;1,2,2,4-tetramethylquinoline |
| SMILES | CC1=CC(C)(C)N(C)c2ccccc21.Nc1ccccc1 |
| InChI | InChI=1S/C13H17N.C6H7N/c1-10-9-13(2,3)14(4)12-8-6-5-7-11(10)12;7-6-4-2-1-3-5-6/h5-9H,1-4H3;1-5H,7H2 |
| InChIKey | HVKXORJGUUODKX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;1,2,2,4-tetramethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;1,2,2,4-tetramethylquinoline?
The IUPAC name of aniline;1,2,2,4-tetramethylquinoline (CID 174979716) is aniline;1,2,2,4-tetramethylquinoline.
What is the SMILES notation for aniline;1,2,2,4-tetramethylquinoline?
The canonical SMILES for aniline;1,2,2,4-tetramethylquinoline is CC1=CC(C)(C)N(C)c2ccccc21.Nc1ccccc1.
What is the InChIKey of aniline;1,2,2,4-tetramethylquinoline?
The InChIKey is HVKXORJGUUODKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N.C6H7N/c1-10-9-13(2,3)14(4)12-8-6-5-7-11(10)12;7-6-4-2-1-3-5-6/h5-9H,1-4H3;1-5H,7H2.
What are the key properties of aniline;1,2,2,4-tetramethylquinoline?
aniline;1,2,2,4-tetramethylquinoline has a molecular weight of 280.42 g/mol, XLogP of 4.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;1,2,2,4-tetramethylquinoline is sourced from PubChem (CID 174979716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).