About acetonitrile;acetyl bromide
acetonitrile;acetyl bromide (PubChem CID 174980514) has the molecular formula C4H6BrNO
and a molecular weight of 164.00 g/mol. Its IUPAC name is acetonitrile;acetyl bromide.
Molecular Properties
| Compound Name | acetonitrile;acetyl bromide |
| PubChem CID | 174980514 |
| Molecular Formula | C4H6BrNO |
| Molecular Weight | 164.00 g/mol |
| Exact Mass | 162.96 |
| IUPAC Name | acetonitrile;acetyl bromide |
| SMILES | CC#N.CC(=O)Br |
| InChI | InChI=1S/C2H3BrO.C2H3N/c1-2(3)4;1-2-3/h1H3;1H3 |
| InChIKey | QXOFKWDIWYCBAW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.00 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;acetyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;acetyl bromide?
The IUPAC name of acetonitrile;acetyl bromide (CID 174980514) is acetonitrile;acetyl bromide.
What is the SMILES notation for acetonitrile;acetyl bromide?
The canonical SMILES for acetonitrile;acetyl bromide is CC#N.CC(=O)Br.
What is the InChIKey of acetonitrile;acetyl bromide?
The InChIKey is QXOFKWDIWYCBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3BrO.C2H3N/c1-2(3)4;1-2-3/h1H3;1H3.
What are the key properties of acetonitrile;acetyl bromide?
acetonitrile;acetyl bromide has a molecular weight of 164.00 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;acetyl bromide is sourced from PubChem (CID 174980514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).