C16H10ClFN6O3 — CID 174980814
(4S)-4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-2,3,6-trione (PubChem CID 174980814) has the molecular formula C16H10ClFN6O3 and a molecular weight of 388.75 g/mol. Its IUPAC name is (4S)-4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-2,3,6-trione.
| Compound Name | (4S)-4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-2,3,6-trione |
|---|---|
| PubChem CID | 174980814 |
| Molecular Formula | C16H10ClFN6O3 |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | (4S)-4-[[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-2,3,6-trione |
| SMILES | O=C1C[C@H](Nc2nc(-c3c[nH]c4ncc(Cl)cc34)ncc2F)C(=O)C(=O)N1 |
| InChI | InChI=1S/C16H10ClFN6O3/c17-6-1-7-8(4-20-13(7)19-3-6)14-21-5-9(18)15(24-14)22-10-2-11(25)23-16(27)12(10)26/h1,3-5,10H,2H2,(H,19,20)(H,21,22,24)(H,23,25,27)/t10-/m0/s1 |
| InChIKey | SOLXWIMJJSFVFW-JTQLQIEISA-N |
| XLogP | 1.21 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|