About trichlorobismuthane;trichlorostibane
trichlorobismuthane;trichlorostibane (PubChem CID 174980821) has the molecular formula BiCl6Sb
and a molecular weight of 543.46 g/mol. Its IUPAC name is trichlorobismuthane;trichlorostibane.
Molecular Properties
| Compound Name | trichlorobismuthane;trichlorostibane |
| PubChem CID | 174980821 |
| Molecular Formula | BiCl6Sb |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 539.70 |
| IUPAC Name | trichlorobismuthane;trichlorostibane |
| SMILES | Cl[Bi](Cl)Cl.Cl[Sb](Cl)Cl |
| InChI | InChI=1S/Bi.6ClH.Sb/h;6*1H;/q+3;;;;;;;+3/p-6 |
| InChIKey | XPFWRDAWFVVLPR-UHFFFAOYSA-H |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trichlorobismuthane;trichlorostibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichlorobismuthane;trichlorostibane?
The IUPAC name of trichlorobismuthane;trichlorostibane (CID 174980821) is trichlorobismuthane;trichlorostibane.
What is the SMILES notation for trichlorobismuthane;trichlorostibane?
The canonical SMILES for trichlorobismuthane;trichlorostibane is Cl[Bi](Cl)Cl.Cl[Sb](Cl)Cl.
What is the InChIKey of trichlorobismuthane;trichlorostibane?
The InChIKey is XPFWRDAWFVVLPR-UHFFFAOYSA-H. The full InChI is InChI=1S/Bi.6ClH.Sb/h;6*1H;/q+3;;;;;;;+3/p-6.
What are the key properties of trichlorobismuthane;trichlorostibane?
trichlorobismuthane;trichlorostibane has a molecular weight of 543.46 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichlorobismuthane;trichlorostibane is sourced from PubChem (CID 174980821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).