About hexane;methyl-(2-methylphenyl)carbamic acid
hexane;methyl-(2-methylphenyl)carbamic acid (PubChem CID 174980979) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is hexane;methyl-(2-methylphenyl)carbamic acid.
Molecular Properties
| Compound Name | hexane;methyl-(2-methylphenyl)carbamic acid |
| PubChem CID | 174980979 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | hexane;methyl-(2-methylphenyl)carbamic acid |
| SMILES | CCCCCC.Cc1ccccc1N(C)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H14/c1-7-5-3-4-6-8(7)10(2)9(11)12;1-3-5-6-4-2/h3-6H,1-2H3,(H,11,12);3-6H2,1-2H3 |
| InChIKey | RMVZNTSTLBXHEI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;methyl-(2-methylphenyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;methyl-(2-methylphenyl)carbamic acid?
The IUPAC name of hexane;methyl-(2-methylphenyl)carbamic acid (CID 174980979) is hexane;methyl-(2-methylphenyl)carbamic acid.
What is the SMILES notation for hexane;methyl-(2-methylphenyl)carbamic acid?
The canonical SMILES for hexane;methyl-(2-methylphenyl)carbamic acid is CCCCCC.Cc1ccccc1N(C)C(=O)O.
What is the InChIKey of hexane;methyl-(2-methylphenyl)carbamic acid?
The InChIKey is RMVZNTSTLBXHEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C6H14/c1-7-5-3-4-6-8(7)10(2)9(11)12;1-3-5-6-4-2/h3-6H,1-2H3,(H,11,12);3-6H2,1-2H3.
What are the key properties of hexane;methyl-(2-methylphenyl)carbamic acid?
hexane;methyl-(2-methylphenyl)carbamic acid has a molecular weight of 251.37 g/mol, XLogP of 4.70, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;methyl-(2-methylphenyl)carbamic acid is sourced from PubChem (CID 174980979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).