C19H27N3 — CID 174981001
1-N-(1,2,3,4-tetrahydroacridin-9-yl)hexane-1,2-diamine (PubChem CID 174981001) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 1-N-(1,2,3,4-tetrahydroacridin-9-yl)hexane-1,2-diamine.
| Compound Name | 1-N-(1,2,3,4-tetrahydroacridin-9-yl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 174981001 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-N-(1,2,3,4-tetrahydroacridin-9-yl)hexane-1,2-diamine |
| SMILES | CCCCC(N)CNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C19H27N3/c1-2-3-8-14(20)13-21-19-15-9-4-6-11-17(15)22-18-12-7-5-10-16(18)19/h4,6,9,11,14H,2-3,5,7-8,10,12-13,20H2,1H3,(H,21,22) |
| InChIKey | VWWPUUVOLMVPLO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |