C18H20F2O7P+ — CID 174981748
[5-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)ethyl]-2-methoxyphenoxy]-hydroxy-oxophosphanium (PubChem CID 174981748) has the molecular formula C18H20F2O7P+ and a molecular weight of 417.32 g/mol. Its IUPAC name is [5-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)ethyl]-2-methoxyphenoxy]-hydroxy-oxophosphanium.
| Compound Name | [5-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)ethyl]-2-methoxyphenoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174981748 |
| Molecular Formula | C18H20F2O7P+ |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [5-[2,2-difluoro-2-(3,4,5-trimethoxyphenyl)ethyl]-2-methoxyphenoxy]-hydroxy-oxophosphanium |
| SMILES | COc1ccc(CC(F)(F)c2cc(OC)c(OC)c(OC)c2)cc1O[P+](=O)O |
| InChI | InChI=1S/C18H19F2O7P/c1-23-13-6-5-11(7-14(13)27-28(21)22)10-18(19,20)12-8-15(24-2)17(26-4)16(9-12)25-3/h5-9H,10H2,1-4H3/p+1 |
| InChIKey | UBUFEEJCTYSTNR-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|