About bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol
bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol (PubChem CID 174982090) has the molecular formula C8H10O2S2
and a molecular weight of 202.30 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol |
| PubChem CID | 174982090 |
| Molecular Formula | C8H10O2S2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol |
| SMILES | OCCOSS.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.C2H6O2S2/c1-2-6-4-3-5(1)6;3-1-2-4-6-5/h1-4H;3,5H,1-2H2 |
| InChIKey | GXEROYRKNBVIDP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol (CID 174982090) is bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol is OCCOSS.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol?
The InChIKey is GXEROYRKNBVIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C2H6O2S2/c1-2-6-4-3-5(1)6;3-1-2-4-6-5/h1-4H;3,5H,1-2H2.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol?
bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol has a molecular weight of 202.30 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;2-(disulfanyloxy)ethanol is sourced from PubChem (CID 174982090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).