C13H6F5O5SZr- — CID 174982274
2-hydroxybenzaldehyde;(2,3,4,5,6-pentafluorophenyl) sulfite;zirconium (PubChem CID 174982274) has the molecular formula C13H6F5O5SZr- and a molecular weight of 460.47 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;(2,3,4,5,6-pentafluorophenyl) sulfite;zirconium.
| Compound Name | 2-hydroxybenzaldehyde;(2,3,4,5,6-pentafluorophenyl) sulfite;zirconium |
|---|---|
| PubChem CID | 174982274 |
| Molecular Formula | C13H6F5O5SZr- |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 458.89 |
| IUPAC Name | 2-hydroxybenzaldehyde;(2,3,4,5,6-pentafluorophenyl) sulfite;zirconium |
| SMILES | O=Cc1ccccc1O.O=S([O-])Oc1c(F)c(F)c(F)c(F)c1F.[Zr] |
| InChI | InChI=1S/C7H6O2.C6HF5O3S.Zr/c8-5-6-3-1-2-4-7(6)9;7-1-2(8)4(10)6(14-15(12)13)5(11)3(1)9;/h1-5,9H;(H,12,13);/p-1 |
| InChIKey | LMUHJIOZDHNRFO-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|