About ethenylsilane;heptylbenzene
ethenylsilane;heptylbenzene (PubChem CID 174982410) has the molecular formula C15H26Si
and a molecular weight of 234.46 g/mol. Its IUPAC name is ethenylsilane;heptylbenzene.
Molecular Properties
| Compound Name | ethenylsilane;heptylbenzene |
| PubChem CID | 174982410 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | ethenylsilane;heptylbenzene |
| SMILES | C=C[SiH3].CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C13H20.C2H6Si/c1-2-3-4-5-7-10-13-11-8-6-9-12-13;1-2-3/h6,8-9,11-12H,2-5,7,10H2,1H3;2H,1H2,3H3 |
| InChIKey | LWLNMYFHPHQHPP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenylsilane;heptylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylsilane;heptylbenzene?
The IUPAC name of ethenylsilane;heptylbenzene (CID 174982410) is ethenylsilane;heptylbenzene.
What is the SMILES notation for ethenylsilane;heptylbenzene?
The canonical SMILES for ethenylsilane;heptylbenzene is C=C[SiH3].CCCCCCCc1ccccc1.
What is the InChIKey of ethenylsilane;heptylbenzene?
The InChIKey is LWLNMYFHPHQHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20.C2H6Si/c1-2-3-4-5-7-10-13-11-8-6-9-12-13;1-2-3/h6,8-9,11-12H,2-5,7,10H2,1H3;2H,1H2,3H3.
What are the key properties of ethenylsilane;heptylbenzene?
ethenylsilane;heptylbenzene has a molecular weight of 234.46 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylsilane;heptylbenzene is sourced from PubChem (CID 174982410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).