About (2-chlorophenyl)methyl trimethyl silicate
(2-chlorophenyl)methyl trimethyl silicate (PubChem CID 174982412) has the molecular formula C10H15ClO4Si
and a molecular weight of 262.76 g/mol. Its IUPAC name is (2-chlorophenyl)methyl trimethyl silicate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl trimethyl silicate |
| PubChem CID | 174982412 |
| Molecular Formula | C10H15ClO4Si |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | (2-chlorophenyl)methyl trimethyl silicate |
| SMILES | CO[Si](OC)(OC)OCc1ccccc1Cl |
| InChI | InChI=1S/C10H15ClO4Si/c1-12-16(13-2,14-3)15-8-9-6-4-5-7-10(9)11/h4-7H,8H2,1-3H3 |
| InChIKey | GXSUUBNOYRDDOU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)methyl trimethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl trimethyl silicate?
The IUPAC name of (2-chlorophenyl)methyl trimethyl silicate (CID 174982412) is (2-chlorophenyl)methyl trimethyl silicate.
What is the SMILES notation for (2-chlorophenyl)methyl trimethyl silicate?
The canonical SMILES for (2-chlorophenyl)methyl trimethyl silicate is CO[Si](OC)(OC)OCc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)methyl trimethyl silicate?
The InChIKey is GXSUUBNOYRDDOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClO4Si/c1-12-16(13-2,14-3)15-8-9-6-4-5-7-10(9)11/h4-7H,8H2,1-3H3.
What are the key properties of (2-chlorophenyl)methyl trimethyl silicate?
(2-chlorophenyl)methyl trimethyl silicate has a molecular weight of 262.76 g/mol, XLogP of 2.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl trimethyl silicate is sourced from PubChem (CID 174982412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).