C21H27FN2O6 — CID 174982825
[(1S)-1-[4-carbonofluoridoyl-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-yl]ethyl] N-tert-butylcarbamate (PubChem CID 174982825) has the molecular formula C21H27FN2O6 and a molecular weight of 422.45 g/mol. Its IUPAC name is [(1S)-1-[4-carbonofluoridoyl-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-yl]ethyl] N-tert-butylcarbamate.
| Compound Name | [(1S)-1-[4-carbonofluoridoyl-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-yl]ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174982825 |
| Molecular Formula | C21H27FN2O6 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(1S)-1-[4-carbonofluoridoyl-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-yl]ethyl] N-tert-butylcarbamate |
| SMILES | CCOc1ccc(-c2nc(C(=O)F)c([C@H](C)OC(=O)NC(C)(C)C)o2)cc1OCC |
| InChI | InChI=1S/C21H27FN2O6/c1-7-27-14-10-9-13(11-15(14)28-8-2)19-23-16(18(22)25)17(30-19)12(3)29-20(26)24-21(4,5)6/h9-12H,7-8H2,1-6H3,(H,24,26)/t12-/m0/s1 |
| InChIKey | IUSZKVUOXHYVKQ-LBPRGKRZSA-N |
| XLogP | 4.83 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|