About (2-amino-6-bromophenyl) hexanoate
(2-amino-6-bromophenyl) hexanoate (PubChem CID 174983414) has the molecular formula C12H16BrNO2
and a molecular weight of 286.17 g/mol. Its IUPAC name is (2-amino-6-bromophenyl) hexanoate.
Molecular Properties
| Compound Name | (2-amino-6-bromophenyl) hexanoate |
| PubChem CID | 174983414 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | (2-amino-6-bromophenyl) hexanoate |
| SMILES | CCCCCC(=O)Oc1c(N)cccc1Br |
| InChI | InChI=1S/C12H16BrNO2/c1-2-3-4-8-11(15)16-12-9(13)6-5-7-10(12)14/h5-7H,2-4,8,14H2,1H3 |
| InChIKey | KZOFCQUZGBYRCY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-6-bromophenyl) hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-6-bromophenyl) hexanoate?
The IUPAC name of (2-amino-6-bromophenyl) hexanoate (CID 174983414) is (2-amino-6-bromophenyl) hexanoate.
What is the SMILES notation for (2-amino-6-bromophenyl) hexanoate?
The canonical SMILES for (2-amino-6-bromophenyl) hexanoate is CCCCCC(=O)Oc1c(N)cccc1Br.
What is the InChIKey of (2-amino-6-bromophenyl) hexanoate?
The InChIKey is KZOFCQUZGBYRCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO2/c1-2-3-4-8-11(15)16-12-9(13)6-5-7-10(12)14/h5-7H,2-4,8,14H2,1H3.
What are the key properties of (2-amino-6-bromophenyl) hexanoate?
(2-amino-6-bromophenyl) hexanoate has a molecular weight of 286.17 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-6-bromophenyl) hexanoate is sourced from PubChem (CID 174983414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).