About 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene
5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene (PubChem CID 174983819) has the molecular formula C18H20N2OS
and a molecular weight of 312.44 g/mol. Its IUPAC name is 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene.
Molecular Properties
| Compound Name | 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene |
| PubChem CID | 174983819 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene |
| SMILES | CC(C)(C)c1c[nH]c(=S)[nH]c1=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C8H12N2OS/c1-2-6-10-8-4-3-7-9(10)5-1;1-8(2,3)5-4-9-7(12)10-6(5)11/h1-8H;4H,1-3H3,(H2,9,10,11,12) |
| InChIKey | OJEGHWPXWWDUPB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene?
The IUPAC name of 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene (CID 174983819) is 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene.
What is the SMILES notation for 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene?
The canonical SMILES for 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene is CC(C)(C)c1c[nH]c(=S)[nH]c1=O.c1ccc2ccccc2c1.
What is the InChIKey of 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene?
The InChIKey is OJEGHWPXWWDUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C8H12N2OS/c1-2-6-10-8-4-3-7-9(10)5-1;1-8(2,3)5-4-9-7(12)10-6(5)11/h1-8H;4H,1-3H3,(H2,9,10,11,12).
What are the key properties of 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene?
5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene has a molecular weight of 312.44 g/mol, XLogP of 4.57, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-sulfanylidene-1H-pyrimidin-4-one;naphthalene is sourced from PubChem (CID 174983819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).