C18H21N3O2S2 — CID 17498432
N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 17498432) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 17498432 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[5-methyl-4-(4-propylphenyl)-1,3-thiazol-2-yl]-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | CCCc1ccc(-c2nc(NC(=O)CN3CCSC3=O)sc2C)cc1 |
| InChI | InChI=1S/C18H21N3O2S2/c1-3-4-13-5-7-14(8-6-13)16-12(2)25-17(20-16)19-15(22)11-21-9-10-24-18(21)23/h5-8H,3-4,9-11H2,1-2H3,(H,19,20,22) |
| InChIKey | NEWWQLNJIDNZKJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|