C10H12F6O — CID 174984499
4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexane-1-carbaldehyde (PubChem CID 174984499) has the molecular formula C10H12F6O and a molecular weight of 262.19 g/mol. Its IUPAC name is 4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexane-1-carbaldehyde.
| Compound Name | 4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 174984499 |
| Molecular Formula | C10H12F6O |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexane-1-carbaldehyde |
| SMILES | O=CC1CCC(C(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12F6O/c11-8(9(12,13)10(14,15)16)7-3-1-6(5-17)2-4-7/h5-8H,1-4H2 |
| InChIKey | VWHQRGWMTYKVFR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|