C3H9N5S — CID 174984852
methanamine;1,2,4-thiadiazole-3,5-diamine (PubChem CID 174984852) has the molecular formula C3H9N5S and a molecular weight of 147.21 g/mol. Its IUPAC name is methanamine;1,2,4-thiadiazole-3,5-diamine.
| Compound Name | methanamine;1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 174984852 |
| Molecular Formula | C3H9N5S |
| Molecular Weight | 147.21 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | methanamine;1,2,4-thiadiazole-3,5-diamine |
| SMILES | CN.Nc1nsc(N)n1 |
| InChI | InChI=1S/C2H4N4S.CH5N/c3-1-5-2(4)7-6-1;1-2/h(H4,3,4,5,6);2H2,1H3 |
| InChIKey | ONOIAAXPEMROAD-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |