About calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride
calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride (PubChem CID 174984961) has the molecular formula C6H9CaNO
and a molecular weight of 151.22 g/mol. Its IUPAC name is calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride.
Molecular Properties
| Compound Name | calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride |
| PubChem CID | 174984961 |
| Molecular Formula | C6H9CaNO |
| Molecular Weight | 151.22 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride |
| SMILES | O=C1CC2CC=CN12.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C6H7NO.Ca.2H/c8-6-4-5-2-1-3-7(5)6;;;/h1,3,5H,2,4H2;;;/q;+2;2*-1 |
| InChIKey | PEKRXGICQAVLRI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride?
The IUPAC name of calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride (CID 174984961) is calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride.
What is the SMILES notation for calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride?
The canonical SMILES for calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride is O=C1CC2CC=CN12.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride?
The InChIKey is PEKRXGICQAVLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.Ca.2H/c8-6-4-5-2-1-3-7(5)6;;;/h1,3,5H,2,4H2;;;/q;+2;2*-1.
What are the key properties of calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride?
calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride has a molecular weight of 151.22 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;1-azabicyclo[3.2.0]hept-2-en-7-one;hydride is sourced from PubChem (CID 174984961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).